The Mossbauer spectroscopy, polarization microscopy, differential scanning calorimetry and X-ray photoemission spectroscopy were used to study of structure peculiarities, dynamical and orientational properties and thermal stability of ferrocene mesogens with general formula Fe(C5H4C(CH3)=N-N=CHC6H4COOC6H4OCnH2n+1) where n = 8, 10, 12. The obtained data were compared with those for nonmesomorphic derivatives of ferrocene and organic liquid crystals.